C19H34N2O6 — CID 67802338
tert-butyl 4-[2-(cyclohexylamino)-2-oxoethyl]piperidine-1-carboxylate;carbonic acid (PubChem CID 67802338) has the molecular formula C19H34N2O6 and a molecular weight of 386.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(cyclohexylamino)-2-oxoethyl]piperidine-1-carboxylate;carbonic acid.
| Compound Name | tert-butyl 4-[2-(cyclohexylamino)-2-oxoethyl]piperidine-1-carboxylate;carbonic acid |
|---|---|
| PubChem CID | 67802338 |
| Molecular Formula | C19H34N2O6 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | tert-butyl 4-[2-(cyclohexylamino)-2-oxoethyl]piperidine-1-carboxylate;carbonic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(=O)NC2CCCCC2)CC1.O=C(O)O |
| InChI | InChI=1S/C18H32N2O3.CH2O3/c1-18(2,3)23-17(22)20-11-9-14(10-12-20)13-16(21)19-15-7-5-4-6-8-15;2-1(3)4/h14-15H,4-13H2,1-3H3,(H,19,21);(H2,2,3,4) |
| InChIKey | WBGYZMFTDMTVNM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |