C15H26N2O3S — CID 126824092
tert-butyl 4-[[2-(thietan-3-yl)acetyl]amino]piperidine-1-carboxylate (PubChem CID 126824092) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is tert-butyl 4-[[2-(thietan-3-yl)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(thietan-3-yl)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126824092 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl 4-[[2-(thietan-3-yl)acetyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)CC2CSC2)CC1 |
| InChI | InChI=1S/C15H26N2O3S/c1-15(2,3)20-14(19)17-6-4-12(5-7-17)16-13(18)8-11-9-21-10-11/h11-12H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | YGTCYPFEYVQOGG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |