C14H25N3O3 — CID 71940585
tert-butyl 4-(azetidine-1-carbonylamino)piperidine-1-carboxylate (PubChem CID 71940585) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl 4-(azetidine-1-carbonylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(azetidine-1-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71940585 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | tert-butyl 4-(azetidine-1-carbonylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)N2CCC2)CC1 |
| InChI | InChI=1S/C14H25N3O3/c1-14(2,3)20-13(19)17-9-5-11(6-10-17)15-12(18)16-7-4-8-16/h11H,4-10H2,1-3H3,(H,15,18) |
| InChIKey | KCCAYWCGZIPNRK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |