C13H23N3O3 — CID 108909382
tert-butyl 4-(ethenylcarbamoylamino)piperidine-1-carboxylate (PubChem CID 108909382) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl 4-(ethenylcarbamoylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(ethenylcarbamoylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108909382 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | tert-butyl 4-(ethenylcarbamoylamino)piperidine-1-carboxylate |
| SMILES | C=CNC(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H23N3O3/c1-5-14-11(17)15-10-6-8-16(9-7-10)12(18)19-13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H2,14,15,17) |
| InChIKey | XXLGFFYSMMODHZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |