C12H21N3O5 — CID 108814591
tert-butyl 4-[(2-nitroacetyl)amino]piperidine-1-carboxylate (PubChem CID 108814591) has the molecular formula C12H21N3O5 and a molecular weight of 287.32 g/mol. Its IUPAC name is tert-butyl 4-[(2-nitroacetyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-nitroacetyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108814591 |
| Molecular Formula | C12H21N3O5 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | tert-butyl 4-[(2-nitroacetyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)C[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H21N3O5/c1-12(2,3)20-11(17)14-6-4-9(5-7-14)13-10(16)8-15(18)19/h9H,4-8H2,1-3H3,(H,13,16) |
| InChIKey | AMRYVEPJLPXJCU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|