C16H24N2O3S — CID 71629850
tert-butyl 4-[(2-thiophen-3-ylacetyl)amino]piperidine-1-carboxylate (PubChem CID 71629850) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is tert-butyl 4-[(2-thiophen-3-ylacetyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-thiophen-3-ylacetyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71629850 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl 4-[(2-thiophen-3-ylacetyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)Cc2ccsc2)CC1 |
| InChI | InChI=1S/C16H24N2O3S/c1-16(2,3)21-15(20)18-7-4-13(5-8-18)17-14(19)10-12-6-9-22-11-12/h6,9,11,13H,4-5,7-8,10H2,1-3H3,(H,17,19) |
| InChIKey | ORHJBEVNJHBUAV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |