C17H28N2O2S — CID 112717934
tert-butyl 4-(4-thiophen-3-ylbutyl)piperazine-1-carboxylate (PubChem CID 112717934) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is tert-butyl 4-(4-thiophen-3-ylbutyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-thiophen-3-ylbutyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112717934 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | tert-butyl 4-(4-thiophen-3-ylbutyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCCc2ccsc2)CC1 |
| InChI | InChI=1S/C17H28N2O2S/c1-17(2,3)21-16(20)19-11-9-18(10-12-19)8-5-4-6-15-7-13-22-14-15/h7,13-14H,4-6,8-12H2,1-3H3 |
| InChIKey | WJUVZLVWZJJCNX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|