C19H33N5O2S — CID 111940735
tert-butyl 4-[2-[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate (PubChem CID 111940735) has the molecular formula C19H33N5O2S and a molecular weight of 395.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111940735 |
| Molecular Formula | C19H33N5O2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | tert-butyl 4-[2-[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccsc1)NCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H33N5O2S/c1-5-20-17(22-14-16-6-13-27-15-16)21-7-8-23-9-11-24(12-10-23)18(25)26-19(2,3)4/h6,13,15H,5,7-12,14H2,1-4H3,(H2,20,21,22) |
| InChIKey | VFGPOXQKJCOUPZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|