C20H36N6O2S — CID 111525360
tert-butyl 4-[3-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 111525360) has the molecular formula C20H36N6O2S and a molecular weight of 424.62 g/mol. Its IUPAC name is tert-butyl 4-[3-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111525360 |
| Molecular Formula | C20H36N6O2S |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | tert-butyl 4-[3-[[N-ethyl-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H36N6O2S/c1-6-21-18(24-15-17-23-14-16(2)29-17)22-8-7-9-25-10-12-26(13-11-25)19(27)28-20(3,4)5/h14H,6-13,15H2,1-5H3,(H2,21,22,24) |
| InChIKey | RDPULHAWQZWITI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|