C16H28N6OS — CID 111524178
1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111524178) has the molecular formula C16H28N6OS and a molecular weight of 352.51 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111524178 |
| Molecular Formula | C16H28N6OS |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H28N6OS/c1-4-17-16(20-12-15-19-11-13(2)24-15)18-5-6-21-7-9-22(10-8-21)14(3)23/h11H,4-10,12H2,1-3H3,(H2,17,18,20) |
| InChIKey | QXJDSRTUQOPWTM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|