C19H31N5O — CID 111358982
1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[(2-methylphenyl)methyl]guanidine (PubChem CID 111358982) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[(2-methylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[(2-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111358982 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[(2-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1C)NCCN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H31N5O/c1-4-20-19(22-15-18-8-6-5-7-16(18)2)21-9-10-23-11-13-24(14-12-23)17(3)25/h5-8H,4,9-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | WPPTXRGSLGDNMB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|