C21H29FN6OS — CID 111525098
1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111525098) has the molecular formula C21H29FN6OS and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111525098 |
| Molecular Formula | C21H29FN6OS |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H29FN6OS/c1-3-23-21(26-15-19-25-14-16(2)30-19)24-9-8-20(29)28-12-10-27(11-13-28)18-6-4-17(22)5-7-18/h4-7,14H,3,8-13,15H2,1-2H3,(H2,23,24,26) |
| InChIKey | MDAQBCUKBGYGIL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|