C20H29IN6OS — CID 111523937
1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111523937) has the molecular formula C20H29IN6OS and a molecular weight of 528.46 g/mol. Its IUPAC name is 1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111523937 |
| Molecular Formula | C20H29IN6OS |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCN(c2ccccc2)CC1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C20H28N6OS.HI/c1-3-21-20(23-14-18-22-13-16(2)28-18)24-15-19(27)26-11-9-25(10-12-26)17-7-5-4-6-8-17;/h4-8,13H,3,9-12,14-15H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | AZGDWKKUCSGNEH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|