C19H30FN5OS — CID 111345331
1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-(2-methylsulfanylethyl)guanidine (PubChem CID 111345331) has the molecular formula C19H30FN5OS and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-(2-methylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111345331 |
| Molecular Formula | C19H30FN5OS |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-ethyl-3-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-2-(2-methylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\CCSC)NCCC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H30FN5OS/c1-3-21-19(23-10-15-27-2)22-9-8-18(26)25-13-11-24(12-14-25)17-6-4-16(20)5-7-17/h4-7H,3,8-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | WIAFPIYCBXRSBV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|