C23H32IN5O — CID 110953399
2-benzyl-1-ethyl-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 110953399) has the molecular formula C23H32IN5O and a molecular weight of 521.45 g/mol. Its IUPAC name is 2-benzyl-1-ethyl-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-benzyl-1-ethyl-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110953399 |
| Molecular Formula | C23H32IN5O |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-benzyl-1-ethyl-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1)NCCC(=O)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C23H31N5O.HI/c1-2-24-23(26-19-20-9-5-3-6-10-20)25-14-13-22(29)28-17-15-27(16-18-28)21-11-7-4-8-12-21;/h3-12H,2,13-19H2,1H3,(H2,24,25,26);1H |
| InChIKey | QXNPJWBSMANEAF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|