C22H30ClIN6O — CID 111176737
2-[(3-chlorophenyl)methyl]-1-ethyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111176737) has the molecular formula C22H30ClIN6O and a molecular weight of 556.88 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111176737 |
| Molecular Formula | C22H30ClIN6O |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-1-ethyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cl)c1)NCCC(=O)N1CCN(c2ccccn2)CC1.I |
| InChI | InChI=1S/C22H29ClN6O.HI/c1-2-24-22(27-17-18-6-5-7-19(23)16-18)26-11-9-21(30)29-14-12-28(13-15-29)20-8-3-4-10-25-20;/h3-8,10,16H,2,9,11-15,17H2,1H3,(H2,24,26,27);1H |
| InChIKey | UKOXBRSGYNAHKY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|