C24H34N6O2 — CID 109417508
1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 109417508) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109417508 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCCC(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C24H34N6O2/c1-3-25-23(28-19-24(2,32)20-9-5-4-6-10-20)27-14-12-22(31)30-17-15-29(16-18-30)21-11-7-8-13-26-21/h4-11,13,32H,3,12,14-19H2,1-2H3,(H2,25,27,28) |
| InChIKey | RELBDRDEOMXKCK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|