C23H32N6OS — CID 111372581
1-ethyl-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111372581) has the molecular formula C23H32N6OS and a molecular weight of 440.62 g/mol. Its IUPAC name is 1-ethyl-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111372581 |
| Molecular Formula | C23H32N6OS |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1-ethyl-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\CCC(=O)N1CCN(c2ccccn2)CC1)NCCSc1ccccc1 |
| InChI | InChI=1S/C23H32N6OS/c1-2-24-23(27-14-19-31-20-8-4-3-5-9-20)26-13-11-22(30)29-17-15-28(16-18-29)21-10-6-7-12-25-21/h3-10,12H,2,11,13-19H2,1H3,(H2,24,26,27) |
| InChIKey | BWXWPEBXTLAEKT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|