C23H41IN8O — CID 111320061
1-ethyl-2-(2-methyl-2-piperidin-1-ylpropyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111320061) has the molecular formula C23H41IN8O and a molecular weight of 572.54 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-piperidin-1-ylpropyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-2-piperidin-1-ylpropyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111320061 |
| Molecular Formula | C23H41IN8O |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-piperidin-1-ylpropyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCCCC1)NCCC(=O)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C23H40N8O.HI/c1-4-24-21(28-19-23(2,3)31-13-6-5-7-14-31)25-12-9-20(32)29-15-17-30(18-16-29)22-26-10-8-11-27-22;/h8,10-11H,4-7,9,12-19H2,1-3H3,(H2,24,25,28);1H |
| InChIKey | BFRMNMATMHVHSJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|