C14H24IN7O — CID 110927945
1,2-dimethyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 110927945) has the molecular formula C14H24IN7O and a molecular weight of 433.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110927945 |
| Molecular Formula | C14H24IN7O |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 1,2-dimethyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCCC(=O)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C14H23N7O.HI/c1-15-13(16-2)17-7-4-12(22)20-8-10-21(11-9-20)14-18-5-3-6-19-14;/h3,5-6H,4,7-11H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | PNOMLHBGTPRIPS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|