C22H38N8O — CID 111370433
2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111370433) has the molecular formula C22H38N8O and a molecular weight of 430.60 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111370433 |
| Molecular Formula | C22H38N8O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCCCC1C)NCCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H38N8O/c1-19-7-3-4-13-28(19)14-6-11-24-21(23-2)25-12-8-20(31)29-15-17-30(18-16-29)22-26-9-5-10-27-22/h5,9-10,19H,3-4,6-8,11-18H2,1-2H3,(H2,23,24,25) |
| InChIKey | SNPHBSYSQWHKEU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|