C18H27N9O — CID 111956509
2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111956509) has the molecular formula C18H27N9O and a molecular weight of 385.48 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111956509 |
| Molecular Formula | C18H27N9O |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2-methyl-1-[(2-methylpyrazol-3-yl)methyl]-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCC(=O)N1CCN(c2ncccn2)CC1)NCc1ccnn1C |
| InChI | InChI=1S/C18H27N9O/c1-19-17(23-14-15-4-9-24-25(15)2)20-8-5-16(28)26-10-12-27(13-11-26)18-21-6-3-7-22-18/h3-4,6-7,9H,5,8,10-14H2,1-2H3,(H2,19,20,23) |
| InChIKey | LGOBZXFOPDFBHR-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|