C22H37N7O — CID 111608696
1-(4-cyclopentylbutyl)-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111608696) has the molecular formula C22H37N7O and a molecular weight of 415.59 g/mol. Its IUPAC name is 1-(4-cyclopentylbutyl)-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-(4-cyclopentylbutyl)-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111608696 |
| Molecular Formula | C22H37N7O |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | 1-(4-cyclopentylbutyl)-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCCC1CCCC1)NCCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H37N7O/c1-23-21(24-11-5-4-9-19-7-2-3-8-19)25-14-10-20(30)28-15-17-29(18-16-28)22-26-12-6-13-27-22/h6,12-13,19H,2-5,7-11,14-18H2,1H3,(H2,23,24,25) |
| InChIKey | PKTUVLWKUBHUMK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|