C18H31N7O2 — CID 111224993
1-(3-ethoxypropyl)-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111224993) has the molecular formula C18H31N7O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111224993 |
| Molecular Formula | C18H31N7O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCOCCCN/C(=N\C)NCCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H31N7O2/c1-3-27-15-5-9-20-17(19-2)21-10-6-16(26)24-11-13-25(14-12-24)18-22-7-4-8-23-18/h4,7-8H,3,5-6,9-15H2,1-2H3,(H2,19,20,21) |
| InChIKey | XSBICKBFLMOAGY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|