C21H28F2IN7O2 — CID 111865257
1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111865257) has the molecular formula C21H28F2IN7O2 and a molecular weight of 575.40 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111865257 |
| Molecular Formula | C21H28F2IN7O2 |
| Molecular Weight | 575.40 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)N1CCN(c2ncccn2)CC1)NCc1ccccc1OC(F)F.I |
| InChI | InChI=1S/C21H27F2N7O2.HI/c1-24-20(28-15-16-5-2-3-6-17(16)32-19(22)23)25-10-7-18(31)29-11-13-30(14-12-29)21-26-8-4-9-27-21;/h2-6,8-9,19H,7,10-15H2,1H3,(H2,24,25,28);1H |
| InChIKey | DITWXJGWPLNQBR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|