C19H28N8O2 — CID 109430217
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 109430217) has the molecular formula C19H28N8O2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109430217 |
| Molecular Formula | C19H28N8O2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCC(=O)N1CCN(c2ncccn2)CC1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C19H28N8O2/c1-14-15(2)29-16(25-14)13-24-18(20-3)21-8-5-17(28)26-9-11-27(12-10-26)19-22-6-4-7-23-19/h4,6-7H,5,8-13H2,1-3H3,(H2,20,21,24) |
| InChIKey | KCMSPZORCIUINF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|