C16H28N6O2 — CID 109430843
1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine (PubChem CID 109430843) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109430843 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCN1CCN(C(C)=O)CC1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C16H28N6O2/c1-12-13(2)24-15(20-12)11-19-16(17-4)18-5-6-21-7-9-22(10-8-21)14(3)23/h5-11H2,1-4H3,(H2,17,18,19) |
| InChIKey | KCYBOJIVZKODOL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|