C21H31FN6O — CID 109428343
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-methylguanidine (PubChem CID 109428343) has the molecular formula C21H31FN6O and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-methylguanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109428343 |
| Molecular Formula | C21H31FN6O |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCN1CCN(c2ccccc2F)CC1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C21H31FN6O/c1-16-17(2)29-20(26-16)15-25-21(23-3)24-9-6-10-27-11-13-28(14-12-27)19-8-5-4-7-18(19)22/h4-5,7-8H,6,9-15H2,1-3H3,(H2,23,24,25) |
| InChIKey | NKQJURSOEAGSSZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|