C19H26IN5O — CID 111341584
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 111341584) has the molecular formula C19H26IN5O and a molecular weight of 467.36 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111341584 |
| Molecular Formula | C19H26IN5O |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1ccc2ccccc21)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C19H25N5O.HI/c1-14-15(2)25-18(23-14)13-22-19(20-3)21-10-6-11-24-12-9-16-7-4-5-8-17(16)24;/h4-5,7-9,12H,6,10-11,13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | ZOLMXEUHKGAFTH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|