C18H23N5S — CID 111516391
1-(3-indol-1-ylpropyl)-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111516391) has the molecular formula C18H23N5S and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-(3-indol-1-ylpropyl)-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-(3-indol-1-ylpropyl)-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111516391 |
| Molecular Formula | C18H23N5S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-(3-indol-1-ylpropyl)-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCCn1ccc2ccccc21)NCc1ncc(C)s1 |
| InChI | InChI=1S/C18H23N5S/c1-14-12-21-17(24-14)13-22-18(19-2)20-9-5-10-23-11-8-15-6-3-4-7-16(15)23/h3-4,6-8,11-12H,5,9-10,13H2,1-2H3,(H2,19,20,22) |
| InChIKey | BTXOONHHIMEFCV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|