C11H19FN4O — CID 109428279
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-fluoropropyl)-2-methylguanidine (PubChem CID 109428279) has the molecular formula C11H19FN4O and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-fluoropropyl)-2-methylguanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-fluoropropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109428279 |
| Molecular Formula | C11H19FN4O |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-(3-fluoropropyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCCF)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C11H19FN4O/c1-8-9(2)17-10(16-8)7-15-11(13-3)14-6-4-5-12/h4-7H2,1-3H3,(H2,13,14,15) |
| InChIKey | IGEITQTZRAYGFG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|