C14H25IN4O3 — CID 109429648
ethyl 4-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 109429648) has the molecular formula C14H25IN4O3 and a molecular weight of 424.28 g/mol. Its IUPAC name is ethyl 4-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 109429648 |
| Molecular Formula | C14H25IN4O3 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | ethyl 4-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | CCOC(=O)CCCN/C(=N\C)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C14H24N4O3.HI/c1-5-20-13(19)7-6-8-16-14(15-4)17-9-12-18-10(2)11(3)21-12;/h5-9H2,1-4H3,(H2,15,16,17);1H |
| InChIKey | YCQAZAZYHMPLJX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|