C12H24IN5O3S — CID 109429656
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-(ethylsulfonylamino)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 109429656) has the molecular formula C12H24IN5O3S and a molecular weight of 445.33 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-(ethylsulfonylamino)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-(ethylsulfonylamino)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109429656 |
| Molecular Formula | C12H24IN5O3S |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-(ethylsulfonylamino)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C12H23N5O3S.HI/c1-5-21(18,19)16-7-6-14-12(13-4)15-8-11-17-9(2)10(3)20-11;/h16H,5-8H2,1-4H3,(H2,13,14,15);1H |
| InChIKey | NLKWMXGCBMNGBL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|