C14H28IN5O3S — CID 109429612
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methylguanidine;hydroiodide (PubChem CID 109429612) has the molecular formula C14H28IN5O3S and a molecular weight of 473.38 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109429612 |
| Molecular Formula | C14H28IN5O3S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)(=O)N(C)CCCN/C(=N\C)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C14H27N5O3S.HI/c1-6-23(20,21)19(5)9-7-8-16-14(15-4)17-10-13-18-11(2)12(3)22-13;/h6-10H2,1-5H3,(H2,15,16,17);1H |
| InChIKey | VAEYWKQAHULCLN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|