C9H22N4O2S — CID 75462498
1-[3-[ethylsulfonyl(methyl)amino]propyl]-2,3-dimethylguanidine (PubChem CID 75462498) has the molecular formula C9H22N4O2S and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2,3-dimethylguanidine.
| Compound Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 75462498 |
| Molecular Formula | C9H22N4O2S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2,3-dimethylguanidine |
| SMILES | CCS(=O)(=O)N(C)CCCN/C(=N/C)NC |
| InChI | InChI=1S/C9H22N4O2S/c1-5-16(14,15)13(4)8-6-7-12-9(10-2)11-3/h5-8H2,1-4H3,(H2,10,11,12) |
| InChIKey | LYEDETLFYXULNX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|