C11H24N4O2S — CID 110982045
1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-prop-2-enylguanidine (PubChem CID 110982045) has the molecular formula C11H24N4O2S and a molecular weight of 276.41 g/mol. Its IUPAC name is 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-prop-2-enylguanidine.
| Compound Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110982045 |
| Molecular Formula | C11H24N4O2S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\C)NCCCN(C)S(=O)(=O)CC |
| InChI | InChI=1S/C11H24N4O2S/c1-5-8-13-11(12-3)14-9-7-10-15(4)18(16,17)6-2/h5H,1,6-10H2,2-4H3,(H2,12,13,14) |
| InChIKey | QFEVQNCVILOHGY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|