C16H25N5O3S2 — CID 109431625
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethyl]-2-methylguanidine (PubChem CID 109431625) has the molecular formula C16H25N5O3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethyl]-2-methylguanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109431625 |
| Molecular Formula | C16H25N5O3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cc(C)sc1C)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C16H25N5O3S2/c1-10-8-14(13(4)25-10)26(22,23)20-7-6-18-16(17-5)19-9-15-21-11(2)12(3)24-15/h8,20H,6-7,9H2,1-5H3,(H2,17,18,19) |
| InChIKey | AIDWFNCVYHDXBK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|