C15H22IN5O3 — CID 109430166
N-[2-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 109430166) has the molecular formula C15H22IN5O3 and a molecular weight of 447.28 g/mol. Its IUPAC name is N-[2-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109430166 |
| Molecular Formula | C15H22IN5O3 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[2-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccco1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C15H21N5O3.HI/c1-10-11(2)23-13(20-10)9-19-15(16-3)18-7-6-17-14(21)12-5-4-8-22-12;/h4-5,8H,6-7,9H2,1-3H3,(H,17,21)(H2,16,18,19);1H |
| InChIKey | LDJHUHOKXIFNPM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|