C13H17BrN4OS — CID 109430767
1-[(5-bromothiophen-2-yl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine (PubChem CID 109430767) has the molecular formula C13H17BrN4OS and a molecular weight of 357.28 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109430767 |
| Molecular Formula | C13H17BrN4OS |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1nc(C)c(C)o1)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H17BrN4OS/c1-8-9(2)19-12(18-8)7-17-13(15-3)16-6-10-4-5-11(14)20-10/h4-5H,6-7H2,1-3H3,(H2,15,16,17) |
| InChIKey | LCYNTJSLZOAVCU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|