C12H18N6O — CID 109429567
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 109429567) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109429567 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccn[nH]1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C12H18N6O/c1-8-9(2)19-11(17-8)7-15-12(13-3)14-6-10-4-5-16-18-10/h4-5H,6-7H2,1-3H3,(H,16,18)(H2,13,14,15) |
| InChIKey | RHJCEQIFHCFBMU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|