C13H17FIN5 — CID 111231180
1-[(4-fluorophenyl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111231180) has the molecular formula C13H17FIN5 and a molecular weight of 389.22 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111231180 |
| Molecular Formula | C13H17FIN5 |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(F)cc1)NCc1ccn[nH]1.I |
| InChI | InChI=1S/C13H16FN5.HI/c1-15-13(17-9-12-6-7-18-19-12)16-8-10-2-4-11(14)5-3-10;/h2-7H,8-9H2,1H3,(H,18,19)(H2,15,16,17);1H |
| InChIKey | FLLBJDCVKBAVRX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|