C13H16F2IN5 — CID 111903376
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111903376) has the molecular formula C13H16F2IN5 and a molecular weight of 407.21 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111903376 |
| Molecular Formula | C13H16F2IN5 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccn[nH]1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C13H15F2N5.HI/c1-16-13(18-8-11-4-5-19-20-11)17-7-9-6-10(14)2-3-12(9)15;/h2-6H,7-8H2,1H3,(H,19,20)(H2,16,17,18);1H |
| InChIKey | CQEKLQBAKUFUQJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|