C12H24IN5 — CID 111891774
1-(2-ethylbutyl)-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111891774) has the molecular formula C12H24IN5 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-ethylbutyl)-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111891774 |
| Molecular Formula | C12H24IN5 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-(2-ethylbutyl)-2-methyl-3-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | CCC(CC)CN/C(=N\C)NCc1ccn[nH]1.I |
| InChI | InChI=1S/C12H23N5.HI/c1-4-10(5-2)8-14-12(13-3)15-9-11-6-7-16-17-11;/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,17)(H2,13,14,15);1H |
| InChIKey | DCADHIJYDXWZLO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|