C15H28N6O — CID 111931922
2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111931922) has the molecular formula C15H28N6O and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111931922 |
| Molecular Formula | C15H28N6O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-methyl-1-(3-methyl-2-morpholin-4-ylbutyl)-3-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccn[nH]1)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C15H28N6O/c1-12(2)14(21-6-8-22-9-7-21)11-18-15(16-3)17-10-13-4-5-19-20-13/h4-5,12,14H,6-11H2,1-3H3,(H,19,20)(H2,16,17,18) |
| InChIKey | IWODSNKOTDZIKB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|