C16H28F2N6O — CID 111930271
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine (PubChem CID 111930271) has the molecular formula C16H28F2N6O and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111930271 |
| Molecular Formula | C16H28F2N6O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
| SMILES | C/N=C(\NCc1nccn1C(F)F)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C16H28F2N6O/c1-12(2)13(23-6-8-25-9-7-23)10-21-16(19-3)22-11-14-20-4-5-24(14)15(17)18/h4-5,12-13,15H,6-11H2,1-3H3,(H2,19,21,22) |
| InChIKey | HBXJLCSWUOMIOG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|