C21H23F2N5 — CID 111357170
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-(2,2-diphenylethyl)-2-methylguanidine (PubChem CID 111357170) has the molecular formula C21H23F2N5 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-(2,2-diphenylethyl)-2-methylguanidine.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-(2,2-diphenylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111357170 |
| Molecular Formula | C21H23F2N5 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-(2,2-diphenylethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1nccn1C(F)F)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23F2N5/c1-24-21(27-15-19-25-12-13-28(19)20(22)23)26-14-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-13,18,20H,14-15H2,1H3,(H2,24,26,27) |
| InChIKey | UZUVGFAMZSMJRI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|