C12H15F2N5S — CID 111939037
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine (PubChem CID 111939037) has the molecular formula C12H15F2N5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111939037 |
| Molecular Formula | C12H15F2N5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccsc1)NCc1nccn1C(F)F |
| InChI | InChI=1S/C12H15F2N5S/c1-15-12(17-6-9-2-5-20-8-9)18-7-10-16-3-4-19(10)11(13)14/h2-5,8,11H,6-7H2,1H3,(H2,15,17,18) |
| InChIKey | DTAWDSSYQVCJDR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|