C15H18F2IN5O2 — CID 111845834
1-(1,3-benzodioxol-5-ylmethyl)-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111845834) has the molecular formula C15H18F2IN5O2 and a molecular weight of 465.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111845834 |
| Molecular Formula | C15H18F2IN5O2 |
| Molecular Weight | 465.24 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCc1nccn1C(F)F.I |
| InChI | InChI=1S/C15H17F2N5O2.HI/c1-18-15(21-8-13-19-4-5-22(13)14(16)17)20-7-10-2-3-11-12(6-10)24-9-23-11;/h2-6,14H,7-9H2,1H3,(H2,18,20,21);1H |
| InChIKey | LXMLKVZZTHEAPA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|