C13H17ClIN3O2 — CID 119141160
1-(1,3-benzodioxol-5-ylmethyl)-3-(2-chloroprop-2-enyl)-2-methylguanidine;hydroiodide (PubChem CID 119141160) has the molecular formula C13H17ClIN3O2 and a molecular weight of 409.66 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-chloroprop-2-enyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-chloroprop-2-enyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119141160 |
| Molecular Formula | C13H17ClIN3O2 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-chloroprop-2-enyl)-2-methylguanidine;hydroiodide |
| SMILES | C=C(Cl)CN/C(=N\C)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C13H16ClN3O2.HI/c1-9(14)6-16-13(15-2)17-7-10-3-4-11-12(5-10)19-8-18-11;/h3-5H,1,6-8H2,2H3,(H2,15,16,17);1H |
| InChIKey | UQXQNAVTKLOWJK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|