C17H18BrFIN3O2 — CID 111844189
1-(1,3-benzodioxol-5-ylmethyl)-3-[(5-bromo-2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111844189) has the molecular formula C17H18BrFIN3O2 and a molecular weight of 522.16 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(5-bromo-2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(5-bromo-2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111844189 |
| Molecular Formula | C17H18BrFIN3O2 |
| Molecular Weight | 522.16 g/mol |
| Exact Mass | 520.96 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(5-bromo-2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCc1cc(Br)ccc1F.I |
| InChI | InChI=1S/C17H17BrFN3O2.HI/c1-20-17(22-9-12-7-13(18)3-4-14(12)19)21-8-11-2-5-15-16(6-11)24-10-23-15;/h2-7H,8-10H2,1H3,(H2,20,21,22);1H |
| InChIKey | NHSFEBPXOKSUKT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|